CymitQuimica logo

CAS 1055881-27-0

:

1-(Trifluoromethyl)vinylboronic acid pinacol ester

Description:
1-(Trifluoromethyl)vinylboronic acid pinacol ester is an organoboron compound characterized by the presence of a vinyl group, a trifluoromethyl group, and a boronic acid moiety esterified with pinacol. This compound typically exhibits a high reactivity due to the boronic acid functionality, which can participate in various chemical reactions, including Suzuki-Miyaura cross-coupling reactions, making it valuable in organic synthesis, particularly in the formation of carbon-carbon bonds. The trifluoromethyl group enhances the compound's lipophilicity and can influence its electronic properties, potentially affecting its reactivity and interaction with biological systems. Additionally, the pinacol ester provides stability to the boronic acid, allowing for easier handling and storage. The compound is likely to be a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. Safety precautions should be taken when handling this substance, as organoboron compounds can be sensitive to moisture and may pose health risks if inhaled or ingested.
Formula:C9H14BF3O2
InChI:InChI=1S/C9H14BF3O2/c1-6(9(11,12)13)10-14-7(2,3)8(4,5)15-10/h1H2,2-5H3
InChI key:XIHQTEZBKPUQTH-UHFFFAOYSA-N
SMILES:B1(OC(C(O1)(C)C)(C)C)C(=C)C(F)(F)F
Found 4 products.