
CAS 1055888-89-5
:3-(di-tert-butylphosphino)propane-1-sulfonic acid
Description:
3-(Di-tert-butylphosphino)propane-1-sulfonic acid is a chemical compound characterized by the presence of a sulfonic acid group and a phosphine moiety. This compound features a propane backbone with a sulfonic acid functional group at one end and a di-tert-butylphosphino group at the other, which contributes to its unique properties. The presence of the bulky tert-butyl groups enhances the steric hindrance around the phosphorus atom, influencing its reactivity and coordination behavior. This compound is typically soluble in polar solvents due to the sulfonic acid group, which can also participate in hydrogen bonding. It is often utilized in various applications, including catalysis and as a ligand in coordination chemistry, due to its ability to stabilize metal complexes. Additionally, the sulfonic acid functionality can impart acidic properties, making it useful in various chemical reactions and processes. Overall, this compound is notable for its dual functionality, combining both phosphine and sulfonic acid characteristics, which can be leveraged in synthetic and industrial chemistry.
Formula:(C4H9)2PCH2CH2CH2SO3H
Synonyms:- Di-t-butyl(3-sulfonatopropyl)phosphine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3-[Bis(1,1-dimethylethyl)phosphino]-1-propanesulfonic acid
CAS:Purity:98%Molecular weight:268.3500061Di-t-butyl(3-sulfonatopropyl)phosphine, min. 98%
CAS:Di-t-butyl(3-sulfonatopropyl)phosphine, min. 98%
Formula:(C4H9)2PCH2CH2CH2SO3HPurity:min. 98%Color and Shape:white solidMolecular weight:268.353-[Bis(1,1-dimethylethyl)phosphino]-1-propanesulfonic acid
CAS:3-[Bis(1,1-dimethylethyl)phosphino]-1-propanesulfonic acidPurity:98%Molecular weight:268.35g/molDi-tert-butyl(3-sulfonatopropyl)phosphine
CAS:Formula:C11H25O3PSPurity:97.0%Color and Shape:SolidMolecular weight:268.35



