CAS 105596-42-7
:8b,9a-Dihydro-3-nitropyreno[4,5-b]oxirene
Description:
8b,9a-Dihydro-3-nitropyreno[4,5-b]oxirene, identified by its CAS number 105596-42-7, is a chemical compound that belongs to the class of nitro-substituted polycyclic aromatic compounds. It features a unique oxirane (epoxide) functional group, which contributes to its reactivity and potential applications in organic synthesis. The presence of the nitro group indicates that it may exhibit distinct electronic properties, influencing its behavior in chemical reactions and interactions with biological systems. This compound is characterized by its polycyclic structure, which typically imparts stability and hydrophobic characteristics. The specific arrangement of atoms and functional groups in 8b,9a-Dihydro-3-nitropyreno[4,5-b]oxirene suggests potential utility in fields such as materials science, pharmaceuticals, and environmental chemistry. However, detailed studies on its toxicity, environmental impact, and specific applications are necessary to fully understand its characteristics and potential uses. As with many nitro compounds, caution is advised due to possible explosive properties under certain conditions.
Formula:C16H9NO3
InChI:InChI=1S/C16H9NO3/c18-17(19)12-7-6-11-14-9(12)5-4-8-2-1-3-10(13(8)14)15-16(11)20-15/h1-7,15-16H
InChI key:InChIKey=HSGLBAJOUBFGPZ-UHFFFAOYSA-N
SMILES:N(=O)(=O)C=1C=2C3=C4C(C5C(C3=CC1)O5)=CC=CC4=CC2
Synonyms:- 3-Nitro-8B,9A-Dihydropyreno[4,5-B]Oxirene
- 8b,9a-Dihydro-3-nitropyreno(4,5-b)oxirene
- Ccris 2126
- Pyrene, 4,5-dihydro-4,5-epoxy-1-nitro-
- Pyreno(4,5-b)oxirene, 8b,9a-dihydro-3-nitro-
- 1-Nitropyrene-4,5-oxide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1-Nitropyrene-4,5-oxide
CAS:Controlled ProductApplications 1-Nitropyrene-4,5-oxide is a derivative of 1-Nitropyrene (N519950) one of the most abundant nitropolycylcic aromatic hydrocarbon found in exhaust from diesel engines with potent carcinogenic and mutagenic properties.
References Arce, R., et al.: J. Phys. Chem. A., 112, 10294 (2008);Formula:C16H9NO3Color and Shape:NeatMolecular weight:263.248
