CAS 105598-03-6

2-Methoxy-α-(1-methylethyl)benzenemethanamine

Description:

2-Methoxy-α-(1-methylethyl)benzenemethanamine, also known by its CAS number 105598-03-6, is an organic compound characterized by its aromatic structure and the presence of both methoxy and amine functional groups. This compound features a methoxy group (-OCH3) attached to a benzene ring, which enhances its solubility in organic solvents. The α-(1-methylethyl) substituent indicates the presence of an isopropyl group, contributing to its hydrophobic characteristics. The amine group (-NH2) suggests potential basicity and reactivity, making it a candidate for various chemical reactions, including alkylation and acylation. The compound may exhibit biological activity, potentially interacting with neurotransmitter systems due to its amine functionality. Its physical properties, such as boiling point, melting point, and solubility, would depend on the specific molecular interactions and the presence of functional groups. Safety data should be consulted for handling and storage, as compounds with amine groups can be sensitive to oxidation and may pose health risks if not managed properly.

Formula: C₁₁H₁₇NO

InChI: InChI=1S/C11H17NO/c1-8(2)11(12)9-6-4-5-7-10(9)13-3/h4-8,11H,12H2,1-3H3

InChI key: InChIKey=RHTDWQDMLUWPQU-UHFFFAOYSA-N

SMILES: C(C(C)C)(N)C1=C(OC)C=CC=C1

Synonyms:

• Benzenemethanamine, 2-methoxy-α-(1-methylethyl)-
• 2-Methoxy-α-(1-methylethyl)benzenemethanamine
• 1-(2-Methoxyphenyl)-2-methylpropan-1-amine