CAS 1055995-83-9

1-[(4-Bromo-3-fluorophenyl)sulfonyl]pyrrolidine

Description:

1-[(4-Bromo-3-fluorophenyl)sulfonyl]pyrrolidine is a chemical compound characterized by its unique structural features, which include a pyrrolidine ring and a sulfonyl group attached to a phenyl ring that is further substituted with bromine and fluorine atoms. The presence of the sulfonyl group contributes to its potential reactivity and solubility properties, while the halogen substituents (bromine and fluorine) can influence its electronic characteristics and biological activity. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its molecular structure suggests potential applications in drug development, particularly in targeting specific biological pathways. The compound's stability, solubility, and reactivity can be influenced by the electronic effects of the bromine and fluorine atoms, which can also affect its interactions with biological targets. Overall, 1-[(4-Bromo-3-fluorophenyl)sulfonyl]pyrrolidine represents a versatile scaffold for further exploration in chemical and pharmaceutical research.

Formula: C₁₀H₁₁BrFNO₂S

InChI: InChI=1S/C10H11BrFNO2S/c11-9-4-3-8(7-10(9)12)16(14,15)13-5-1-2-6-13/h3-4,7H,1-2,5-6H2

InChI key: InChIKey=XXEXUDLTMMPDTA-UHFFFAOYSA-N

SMILES: S(=O)(=O)(C1=CC(F)=C(Br)C=C1)N2CCCC2

Synonyms:

• Pyrrolidine, 1-[(4-bromo-3-fluorophenyl)sulfonyl]-
• 1-[(4-Bromo-3-fluorophenyl)sulfonyl]pyrrolidine