
CAS 1055995-84-0
:4-Bromo-N-cyclopropyl-3-fluorobenzenesulfonamide
Description:
4-Bromo-N-cyclopropyl-3-fluorobenzenesulfonamide is a chemical compound characterized by its unique structural features, which include a bromine atom and a fluorine atom attached to a benzene ring, along with a sulfonamide functional group. The presence of the cyclopropyl group contributes to its three-dimensional structure, potentially influencing its reactivity and interactions with biological targets. This compound is likely to exhibit moderate solubility in organic solvents, while its sulfonamide group may impart some degree of polarity, affecting its solubility in aqueous environments. The bromine and fluorine substituents can enhance the compound's lipophilicity and may also play a role in its biological activity, making it of interest in medicinal chemistry. Additionally, the sulfonamide moiety is known for its applications in pharmaceuticals, particularly as antibacterial agents. Overall, the combination of these functional groups suggests that 4-Bromo-N-cyclopropyl-3-fluorobenzenesulfonamide could possess interesting pharmacological properties, warranting further investigation in drug development contexts.
Formula:C9H9BrFNO2S
InChI:InChI=1S/C9H9BrFNO2S/c10-8-4-3-7(5-9(8)11)15(13,14)12-6-1-2-6/h3-6,12H,1-2H2
InChI key:InChIKey=RKELKYBNLSWRSC-UHFFFAOYSA-N
SMILES:S(NC1CC1)(=O)(=O)C2=CC(F)=C(Br)C=C2
Synonyms:- Benzenesulfonamide, 4-bromo-N-cyclopropyl-3-fluoro-
- 4-Bromo-N-cyclopropyl-3-fluorobenzenesulfonamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.