
CAS 1055995-89-5
:4-Bromo-N-cyclopropyl-2-fluorobenzenesulfonamide
Description:
4-Bromo-N-cyclopropyl-2-fluorobenzenesulfonamide is a chemical compound characterized by its unique structural features, which include a bromine atom and a fluorine atom attached to a benzene ring, along with a sulfonamide functional group. The presence of the cyclopropyl group introduces ring strain, which can influence the compound's reactivity and stability. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. Its sulfonamide group suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as sulfonamides are known for their antibacterial properties. The bromine and fluorine substituents can also enhance the compound's biological activity and lipophilicity, making it a candidate for further investigation in drug design. Additionally, the compound's molecular structure may allow for specific interactions with biological targets, which is crucial in the context of pharmacology. Overall, 4-Bromo-N-cyclopropyl-2-fluorobenzenesulfonamide represents a compound of interest in both synthetic and medicinal chemistry.
Formula:C9H9BrFNO2S
InChI:InChI=1S/C9H9BrFNO2S/c10-6-1-4-9(8(11)5-6)15(13,14)12-7-2-3-7/h1,4-5,7,12H,2-3H2
InChI key:InChIKey=IQYRAZWLYFEYOQ-UHFFFAOYSA-N
SMILES:S(NC1CC1)(=O)(=O)C2=C(F)C=C(Br)C=C2
Synonyms:- Benzenesulfonamide, 4-bromo-N-cyclopropyl-2-fluoro-
- 4-Bromo-N-cyclopropyl-2-fluorobenzenesulfonamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.