CAS 10560-45-9: Diphenylmethoxyphenyltetrazoliumchloride
Description:Diphenylmethoxyphenyltetrazolium chloride, commonly referred to as MTT, is a yellow, water-soluble compound widely used in biological and biochemical assays, particularly for assessing cell viability and proliferation. Its structure features a tetrazolium ring, which is crucial for its function in cellular assays. Upon reduction by viable cells, MTT is converted into a purple formazan product, allowing for quantification through spectrophotometry. This transformation is indicative of metabolic activity, making MTT a valuable tool in cytotoxicity studies and drug screening. The compound is stable under normal laboratory conditions but should be protected from light to prevent degradation. MTT is typically used in a buffered aqueous solution, and its solubility and reactivity can be influenced by pH and temperature. Safety precautions should be observed when handling MTT, as it may pose health risks if ingested or inhaled. Overall, its ability to provide a colorimetric readout makes it an essential reagent in various research applications, particularly in the fields of cell biology and pharmacology.
Formula:C20H17ClN4O
InChI:InChI=1/C20H17N4O.ClH/c1-25-19-14-12-16(13-15-19)20-21-23(17-8-4-2-5-9-17)24(22-20)18-10-6-3-7-11-18;/h2-15H,1H3;1H/q+1;/p-1
- Synonyms:
- 2,3-Diphenyl-5-(4-methoxyphenyl)tetrazolium chloride
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 2,3-DIPHENYL-5-(4-METHOXYPHENYL)TETRAZOLIUM CHLORIDE REF: IN-DA003FKRCAS: 10560-45-9 | 80% | 39.00 €~481.00 € | Mon 03 Mar 25 |
![]() | 5-(4-Methoxyphenyl)-2,3-diphenyl-2H-tetrazol-3-ium chloride REF: 10-F765630CAS: 10560-45-9 | 98% | To inquire | Tue 11 Mar 25 |
![]() | 2,3-Diphenyl-5-(4-methoxyphenyl)tetrazolium Chloride REF: 3D-KAA56045CAS: 10560-45-9 | Min. 95% | - - - | Discontinued product |
![discount label](https://static.cymitquimica.com/public/img/discount.png)
2,3-DIPHENYL-5-(4-METHOXYPHENYL)TETRAZOLIUM CHLORIDE
Ref: IN-DA003FKR
10mg | 39.00 € |
![discount label](https://static.cymitquimica.com/public/img/discount.png)
5-(4-Methoxyphenyl)-2,3-diphenyl-2H-tetrazol-3-ium chloride
Ref: 10-F765630
100mg | To inquire |
![discount label](https://static.cymitquimica.com/public/img/discount.png)
2,3-Diphenyl-5-(4-methoxyphenyl)tetrazolium Chloride
Ref: 3D-KAA56045
1g | Discontinued | Request information | |
50mg | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |