CymitQuimica logo

CAS 105601-05-6

:

Carbamic acid, diethyl-, 3-[1-(dimethylamino)ethyl]phenyl ester

Description:
Carbamic acid, diethyl-, 3-[1-(dimethylamino)ethyl]phenyl ester, commonly referred to by its CAS number 105601-05-6, is an organic compound characterized by its carbamate functional group. This substance features a diethyl carbamate moiety, which contributes to its potential applications in medicinal chemistry and as a synthetic intermediate. The presence of a 3-[1-(dimethylamino)ethyl]phenyl group indicates that it has a phenyl ring substituted with a dimethylaminoethyl side chain, which may influence its biological activity and solubility properties. Typically, compounds of this nature exhibit moderate to high lipophilicity due to the presence of aromatic and aliphatic groups, which can affect their pharmacokinetics. Additionally, the dimethylamino group may impart basicity, allowing for interactions with biological targets. Safety and handling considerations are essential, as carbamates can exhibit toxicity and require appropriate precautions during use. Overall, this compound's unique structure suggests potential utility in various chemical and pharmaceutical applications.
Formula:C15H24N2O2
InChI:InChI=1S/C15H24N2O2/c1-6-17(7-2)15(18)19-14-10-8-9-13(11-14)12(3)16(4)5/h8-12H,6-7H2,1-5H3
InChI key:InChIKey=GRLIVEWNSBETGE-UHFFFAOYSA-N
SMILES:C(N(C)C)(C)C1=CC(OC(N(CC)CC)=O)=CC=C1
Synonyms:
  • Carbamic acid, diethyl-, 3-[1-(dimethylamino)ethyl]phenyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.