CymitQuimica logo

CAS 1056039-83-8

:

2-(2-Methyl-2H-tetrazol-5-yl)-5-(4,4,5,5-tetraMethyl-1,3,2-dioxaborolan-2-yl)pyridine

Description:
2-(2-Methyl-2H-tetrazol-5-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine is a complex organic compound characterized by its unique structural features, which include a pyridine ring, a tetrazole moiety, and a boron-containing dioxaborolane group. The presence of the tetrazole ring contributes to its potential as a bioactive molecule, often enhancing solubility and stability in various environments. The dioxaborolane group is notable for its ability to participate in boron chemistry, making it useful in various synthetic applications, including drug development and materials science. This compound may exhibit interesting chemical reactivity due to the presence of both nitrogen and boron functionalities, which can engage in coordination chemistry and catalysis. Additionally, the steric bulk provided by the tetramethyl groups can influence its interactions with biological targets or other chemical species. Overall, this compound's unique combination of functional groups and structural features positions it as a potentially valuable entity in both research and industrial applications.
Formula:C13H18BN5O2
InChI:InChI=1S/C13H18BN5O2/c1-12(2)13(3,4)21-14(20-12)9-6-7-10(15-8-9)11-16-18-19(5)17-11/h6-8H,1-5H3
InChI key:VOEFRGFXMMXFGK-UHFFFAOYSA-N
SMILES:B1(OC(C(O1)(C)C)(C)C)C2=CN=C(C=C2)C3=NN(N=N3)C
Synonyms:
  • Tedizolid intermediate H
  • 2-(2-Methyl-2H-tetrazol-5-yl)pyridine-5-boronic acid pinacol ester
  • Pyridine, 2-(2-methyl-2H-tetrazol-5-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
  • 2-(2-Methyl-2H-tetrazol-5-yl)-5-(4,4,5,5-tetraMethyl-1,3,2-dioxaborolan-2-yl)pyridine
Found 7 products.