CAS 105605-66-1
:perfucol
Description:
Perfucol, identified by its CAS number 105605-66-1, is a chemical compound that belongs to the class of perfluorinated compounds. These substances are characterized by the presence of carbon-fluorine bonds, which impart unique properties such as high thermal stability, chemical inertness, and low surface tension. Perfucol is often utilized in various industrial applications, including as a surfactant or in formulations requiring water and oil repellency. Its perfluorinated nature contributes to its effectiveness in reducing surface energy, making it valuable in coatings and treatments. However, like many perfluorinated compounds, Perfucol may raise environmental and health concerns due to its persistence in the environment and potential bioaccumulation. Regulatory scrutiny surrounding perfluorinated substances has increased, leading to ongoing research into their safety and ecological impact. Understanding the characteristics and behavior of Perfucol is essential for assessing its applications and implications in both industrial and environmental contexts.
Formula:C13H2F25N
InChI:InChI=1/C10F18.C3H2F7N/c11-1-2(12,5(17,18)9(25,26)7(21,22)3(1,13)14)6(19,20)10(27,28)8(23,24)4(1,15)16;4-1(5,2(6,7)8)3(9,10)11/h;11H2
SMILES:C12(C(C(C(C(C1(F)F)(F)F)(F)F)(F)F)(C(C(C(C2(F)F)(F)F)(F)F)(F)F)F)F.C(C(F)(F)F)(C(F)(F)N)(F)F
Synonyms:- Perfukol
- 1-Propanamine, 1,1,2,2,3,3,3-heptafluoro-, mixt. with octadecafluorodecahydronaphthalene
- 1,1,2,2,3,3,3-Heptafluoropropan-1-Amine - Octadecafluorodecahydronaphthalene (1:1)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
1,1,2,2,3,3,4,4,4a,5,5,6,6,7,7,8,8,8a-Octadecafluoronaphthalene; 1,1,2,2,3,3,3-Heptafluoropropan-1-Amine
CAS:Controlled Product1,1,2,2,3,3,4,4a,5-Octadecafluoronaphthalene is a fluorinated derivative of an organic compound that is used as an intestinal antiseptic and as a cardioplegic solution. Sodium salts of this drug are used to treat intestinal disorders such as colitis and Crohn's disease. It is also used to treat cardiac diseases such as myocardial infarction by reducing the size of the infarcted area. The drug has been shown to be effective in preventing muscle degeneration in patients with AIDS. 1,1,2,2,3,3-Heptafluoropropan-1-amine is a chemical that belongs to the group of adjuvant therapies. It is used as a pharmaceutical preparation for kinetic studies and particle characterization.Formula:C13H2F25NPurity:Min. 95%Molecular weight:647.12 g/mol
