CAS 105612-50-8
:2-METHOXYISONICOTINAMIDE
Description:
2-Methoxyisonicotinamide, with the CAS number 105612-50-8, is a chemical compound that belongs to the class of isonicotinamides, which are derivatives of nicotinic acid. This compound features a methoxy group (-OCH3) attached to the isonicotinamide structure, which is characterized by a pyridine ring fused with an amide group. The presence of the methoxy group can influence the compound's solubility, reactivity, and biological activity. Typically, isonicotinamides are of interest in medicinal chemistry due to their potential pharmacological properties, including antimicrobial and anti-inflammatory effects. The compound may exhibit moderate to high polarity due to the functional groups present, affecting its interaction with biological systems. Additionally, its structural features suggest potential applications in drug development and synthesis. As with many organic compounds, safety and handling precautions should be observed, as the specific toxicity and environmental impact of 2-methoxyisonicotinamide would need to be assessed through appropriate studies.
Formula:C7H8N2O2
InChI:InChI=1/C7H8N2O2/c1-11-6-4-5(7(8)10)2-3-9-6/h2-4H,1H3,(H2,8,10)
SMILES:COc1cc(ccn1)C(=N)O
Synonyms:- Buttpark 91\57-19
- 4-Pyridinecarboxamide,2-methoxy-(9CI)
- 2-Methoxypyridine-4-carboxamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
2-Methoxyisonicotinamide
CAS:2-Methoxyisonicotinamide
Color and Shape:PowderMolecular weight:152.15g/mol

