CAS 105614-25-3

2,2-DIFLUOROCYCLOPROP-1-YLAMINE HYDROCHLORIDE

Description:

2,2-Difluorocycloprop-1-ylamine hydrochloride is a chemical compound characterized by its unique cyclopropane structure, which features two fluorine atoms attached to the cyclopropane ring and an amine functional group. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in water and makes it suitable for various applications in organic synthesis and medicinal chemistry. The presence of fluorine atoms can significantly influence the compound's reactivity and biological activity, often enhancing lipophilicity and metabolic stability. As a primary amine, it can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. The hydrochloride form is commonly used in laboratory settings due to its stability and ease of handling. Safety data sheets should be consulted for handling precautions, as amines can be irritants and may pose health risks. Overall, 2,2-difluorocycloprop-1-ylamine hydrochloride is a valuable compound in research and development, particularly in the fields of pharmaceuticals and agrochemicals.

Formula: C₃H₆ClF₂N

InChI: InChI=1/C3H5F2N.ClH/c4-3(5)1-2(3)6;/h2H,1,6H2;1H

SMILES: C1C(C1(F)F)N.Cl

Synonyms:

• 2,2-Difluorocyclopropanamine Hydrochloride
• 2,2-Difluorocyclopropanamine
• Ethyl 4-{[3-Chloro-5-(Trifluoromethyl)Pyridin-2-Yl]Oxy}Benzoate

2,2-Difluorocyclopropylamine hydrochloride

CAS: 105614-25-3

Formula: C₃H₆ClF₂N

Purity: 95%

Color and Shape: Solid

Molecular weight: 129.5362

Ref: IN-DA0038C2

2,2-Difluorocyclopropan-1-amine hydrochloride

CAS: 105614-25-3

2,2-Difluorocyclopropan-1-amine hydrochloride

Formula: C₃H₅F₂N·ClH

Purity: 97%

Color and Shape: pale yellow solid

Molecular weight: 129.54g/mol

Ref: 54-PC9178

2,2-Difluorocyclopropylamine hydrochloride

CAS: 105614-25-3

Formula: C₃H₆ClF₂N

Purity: 95%

Color and Shape: Solid

Molecular weight: 129.53

Ref: 10-F044163