CAS 105618-02-8
:Galamustine
Description:
Galamustine, with the CAS number 105618-02-8, is a synthetic alkylating agent primarily used in the field of oncology. It is a derivative of nitrogen mustard and functions by interfering with DNA replication and transcription, ultimately leading to cell death, particularly in rapidly dividing cancer cells. Galamutine is characterized by its ability to form covalent bonds with nucleophilic sites on DNA, which results in cross-linking and disruption of the double helix structure. This mechanism of action makes it effective against various types of tumors. The compound is typically administered intravenously and may be used in combination with other chemotherapeutic agents to enhance therapeutic efficacy. Its pharmacokinetics, including absorption, distribution, metabolism, and excretion, are crucial for determining dosing regimens and potential side effects. As with many chemotherapeutic agents, monitoring for adverse effects, such as myelosuppression and gastrointestinal disturbances, is essential during treatment. Overall, Galamustine represents a significant tool in the arsenal against cancer, although its use must be carefully managed due to its potent effects on both cancerous and healthy cells.
Formula:C10H19Cl2NO5
InChI:InChI=1/C10H19Cl2NO5/c11-1-3-13(4-2-12)5-6-7(14)8(15)9(16)10(17)18-6/h6-10,14-17H,1-5H2/t6-,7+,8+,9-,10?/m1/s1
Synonyms:- 6-(Bis(2-chloroethyl)amino)-6-deoxy-D-galactopyranose
- C6-galactose mustard
- D-Galactopyranose, 6-(bis(2-chloroethyl)amino)-6-deoxy-
- Galamustine [INN]
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Galamustine Hydrochloride (>85%)
CAS:Controlled ProductFormula:C10H19Cl2NO5•x(HCl)Purity:>85%Color and Shape:NeatMolecular weight:304.16
