CAS 105624-86-0
:2-[2,6-Bis(1-methylethyl)phenyl]-5-hydroxy-1H-isoindole-1,3(2H)-dione
Description:
2-[2,6-Bis(1-methylethyl)phenyl]-5-hydroxy-1H-isoindole-1,3(2H)-dione, also known by its CAS number 105624-86-0, is a synthetic organic compound characterized by its complex structure, which includes an isoindole core with hydroxy and diketone functionalities. This compound features a bulky substituent, specifically a 2,6-bis(1-methylethyl)phenyl group, which contributes to its steric properties and potentially influences its reactivity and solubility. The presence of the hydroxy group suggests that it may exhibit hydrogen-bonding capabilities, which can affect its interactions in various chemical environments. Additionally, the diketone moiety may participate in various chemical reactions, including condensation and oxidation processes. This compound is of interest in the fields of organic synthesis and materials science, where its unique structural features may be exploited for specific applications, such as in the development of dyes, pharmaceuticals, or as intermediates in organic reactions. Its stability, solubility, and reactivity would depend on the specific conditions under which it is used.
Formula:C20H21NO3
InChI:InChI=1S/C20H21NO3/c1-11(2)14-6-5-7-15(12(3)4)18(14)21-19(23)16-9-8-13(22)10-17(16)20(21)24/h5-12,22H,1-4H3
InChI key:InChIKey=LAKWINYVWJPHQW-UHFFFAOYSA-N
SMILES:C(C)(C)C1=C(C(C(C)C)=CC=C1)N2C(=O)C=3C(C2=O)=CC(O)=CC3
Synonyms:- 1H-Isoindole-1,3(2H)-dione, 2-[2,6-bis(1-methylethyl)phenyl]-5-hydroxy-
- 2-[2,6-Bis(1-methylethyl)phenyl]-5-hydroxy-1H-isoindole-1,3(2H)-dione
- 2-(2,6-Diisopropylphenyl)-5-hydroxyisoindoline-1,3-dione
- 5HPP33
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.

