CymitQuimica logo

CAS 1056264-66-4

:

2-bromo-3-chloro-6-fluorobenzaldehyde

Description:
2-Bromo-3-chloro-6-fluorobenzaldehyde is an aromatic compound characterized by the presence of a benzaldehyde functional group, which features a carbonyl group (C=O) directly attached to a benzene ring. This compound contains three halogen substituents: bromine, chlorine, and fluorine, located at the 2, 3, and 6 positions of the benzene ring, respectively. The presence of these halogens significantly influences the compound's reactivity, polarity, and potential applications in organic synthesis and medicinal chemistry. The electron-withdrawing nature of the halogens can enhance the electrophilicity of the carbonyl carbon, making it more reactive towards nucleophiles. Additionally, the compound may exhibit interesting physical properties, such as solubility in organic solvents and specific melting and boiling points, which are influenced by the halogen substituents. Its unique structure may also contribute to biological activity, making it a candidate for further research in drug development or as an intermediate in the synthesis of more complex organic molecules.
Formula:C7H3BrClFO
InChI:InChI=1S/C7H3BrClFO/c8-7-4(3-11)6(10)2-1-5(7)9/h1-3H
InChI key:XDWZRCXBBQWCBS-UHFFFAOYSA-N
SMILES:C1=CC(=C(C(=C1F)C=O)Br)Cl
Found 4 products.