CAS 105627-79-0
:Isoquinoline-5-sulphonyl chloride hydrochloride
Description:
Isoquinoline-5-sulphonyl chloride hydrochloride is a chemical compound characterized by its sulphonyl chloride functional group attached to an isoquinoline ring system. This compound typically appears as a white to off-white solid and is known for its reactivity, particularly in nucleophilic substitution reactions due to the presence of the sulphonyl chloride group. It is soluble in polar organic solvents, which facilitates its use in various chemical syntheses. The compound is often utilized in medicinal chemistry and organic synthesis as a building block for the development of pharmaceuticals and other bioactive molecules. Its hydrochloride form indicates the presence of hydrochloric acid, which enhances its stability and solubility in aqueous solutions. As with many sulphonyl chlorides, it can release hydrochloric acid upon hydrolysis, making it important to handle with care in a controlled environment to avoid unwanted reactions. Proper safety measures should be observed due to its potential irritant properties and reactivity with water and amines.
Formula:C9H7Cl2NO2S
InChI:InChI=1/C9H6ClNO2S.ClH/c10-14(12,13)9-3-1-2-7-6-11-5-4-8(7)9;/h1-6H;1H
SMILES:c1cc2cnccc2c(c1)S(=O)(=O)Cl.Cl
Synonyms:- Isoquinoline-5-Sulphonyl
- Isoquinoline-5-Sulfonyl Chloride Hydrochloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Isoquinoline-5-sulphonyl chloride, HCl
CAS:Formula:C9H7Cl2NO2SPurity:95%Color and Shape:SolidMolecular weight:264.1284Isoquinoline-5-sulphonyl chloride hydrochloride
CAS:Isoquinoline-5-sulphonyl chloride hydrochlorideFormula:C9H6ClNO2S·ClHPurity:95%Color and Shape: white solidMolecular weight:264.13g/molIsoquinoline-5-sulfonyl chloride hydrochloride
CAS:Formula:C9H7Cl2NO2SPurity:95%Color and Shape:SolidMolecular weight:264.12Isoquinoline-5-sulfonyl Chloride, Hydrochloride
CAS:Controlled ProductStability Moisture Sensitive
Applications Isoquinoline-5-sulfonyl Chloride, Hydrochloride (cas# 105627-79-0) is a compound useful in organic synthesis.Formula:C9H6ClNO2S·ClHColor and Shape:NeatMolecular weight:264.13



