CAS 105627-80-3
:1-Chloro-5-isoquinolinesulfonic Acid
Description:
1-Chloro-5-isoquinolinesulfonic acid is a chemical compound characterized by its unique structure, which includes a chloro group and a sulfonic acid functional group attached to an isoquinoline ring system. This compound is typically a white to off-white solid, soluble in polar solvents such as water and alcohols, due to the presence of the sulfonic acid group, which enhances its hydrophilicity. It is often used in biochemical research, particularly in studies involving neurotransmitter receptors and ion channels, owing to its ability to act as a selective inhibitor or modulator. The presence of the chloro substituent can influence its reactivity and interaction with biological targets. Additionally, the compound may exhibit acidic properties due to the sulfonic acid group, which can participate in proton transfer reactions. Safety data should be consulted, as with any chemical, to understand its handling, storage, and potential hazards. Overall, 1-chloro-5-isoquinolinesulfonic acid is a valuable tool in chemical and biological research applications.
Formula:C9H6ClNO3S
InChI:InChI=1/C9H6ClNO3S/c10-9-7-2-1-3-8(15(12,13)14)6(7)4-5-11-9/h1-5H,(H,12,13,14)
SMILES:c1cc2c(ccnc2Cl)c(c1)S(=O)(=O)O
Synonyms:- 1-Chloro-5-isoquinoline Sulfonic Acid
- 1-Chloroisoquinoline-5-Sulfonic Acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
1-Chloro-5-isoquinolinesulfonic Acid
CAS:Controlled ProductApplications 1-Chloro-5-isoquinolinesulfonic Acid (cas# 105627-80-3) is a compound useful in organic synthesis.
Formula:C9H6ClNO3SColor and Shape:NeatMolecular weight:243.67


