CAS 105627-81-4

5-Isoquinolinesulfonyl chloride, 1-chloro-, hydrochloride (1:1)

Description:

5-Isoquinolinesulfonyl chloride, 1-chloro-, hydrochloride (1:1) is a chemical compound characterized by its sulfonyl chloride functional group attached to an isoquinoline structure. This compound typically appears as a white to off-white solid and is known for its reactivity, particularly in nucleophilic substitution reactions due to the presence of the sulfonyl chloride moiety. It is soluble in polar organic solvents, which facilitates its use in various synthetic applications, including the preparation of sulfonamide derivatives. The hydrochloride form indicates that it is a salt, enhancing its stability and solubility in aqueous environments. This compound is often utilized in medicinal chemistry and organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. Safety precautions are necessary when handling this substance, as sulfonyl chlorides can be corrosive and may release toxic gases upon reaction with water or amines. Proper storage conditions should be maintained to prevent degradation and ensure safety.

Formula: C₉H₅Cl₂NO₂S·ClH

InChI: InChI=1S/C9H5Cl2NO2S.ClH/c10-9-7-2-1-3-8(15(11,13)14)6(7)4-5-12-9;/h1-5H;1H

InChI key: InChIKey=CSGOGYMPINXURE-UHFFFAOYSA-N

SMILES: S(Cl)(=O)(=O)C=1C2=C(C(Cl)=NC=C2)C=CC1.Cl

Synonyms:

• 5-Isoquinolinesulfonyl chloride, 1-chloro-, hydrochloride
• 5-Isoquinolinesulfonyl chloride, 1-chloro-, hydrochloride (1:1)