CymitQuimica logo

CAS 105634-48-8

:

2-Hydroxy-5-methylaurophenone oxime

Description:
2-Hydroxy-5-methylaurophenone oxime, with the CAS number 105634-48-8, is an organic compound characterized by its oxime functional group, which is derived from the corresponding ketone. This compound typically exhibits properties such as being a solid at room temperature, with potential applications in various fields including organic synthesis and coordination chemistry. The presence of the hydroxyl group contributes to its solubility in polar solvents, while the methyl and phenone moieties influence its reactivity and stability. It may also display chelating properties, allowing it to form complexes with metal ions, which can be useful in analytical chemistry and materials science. Additionally, the compound's structure suggests potential for biological activity, although specific biological properties would require further investigation. Overall, 2-Hydroxy-5-methylaurophenone oxime is a versatile compound with unique characteristics that make it of interest in both research and industrial applications.
Formula:C19H31NO2
InChI:InChI=1S/C19H31NO2/c1-3-4-5-6-7-8-9-10-11-12-18(20-22)17-15-16(2)13-14-19(17)21/h13-15,21-22H,3-12H2,1-2H3
InChI key:InChIKey=OOXQDZTUGOJLHK-UHFFFAOYSA-N
SMILES:C(CCCCCCCCCCC)(=NO)C1=C(O)C=CC(C)=C1
Synonyms:
  • FLM 5011
  • 1-Dodecanone, 1-(2-hydroxy-5-methylphenyl)-, oxime
  • Undecyl 2-hydroxy-5-methylphenyl ketoxime
  • F 5
  • 2-Hydroxy-5-methylaurophenone oxime
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.