CAS 1056459-37-0

5-(5-chloro-1-(3-fluorophenyl)-2-oxopentyl)-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-2-yl acetate

Description:

The chemical substance known as "5-(5-chloro-1-(3-fluorophenyl)-2-oxopentyl)-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-2-yl acetate" is a complex organic compound characterized by its unique structural features, including a thieno[3,2-c]pyridine core and various functional groups. The presence of a chloro substituent and a fluorophenyl group suggests potential biological activity, possibly influencing its pharmacological properties. The acetate moiety indicates that the compound may exhibit ester-like characteristics, which can affect its solubility and reactivity. This compound is likely to be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its intricate structure that may interact with biological targets. Its specific properties, such as melting point, solubility, and stability, would depend on the molecular interactions and the environment in which it is studied. As with many synthetic organic compounds, safety and handling precautions are essential due to potential toxicity or reactivity. Further research would be necessary to fully elucidate its characteristics and potential applications.

Formula: C₂₀H₂₁ClFNO₃S

InChI: InChI=1S/C20H21ClFNO3S/c1-13(24)26-19-11-15-12-23(9-7-18(15)27-19)20(17(25)6-3-8-21)14-4-2-5-16(22)10-14/h2,4-5,10-11,20H,3,6-9,12H2,1H3

SMILES: CC(=O)Oc1cc2CN(CCc2s1)C(c1cccc(c1)F)C(=O)CCCCl

Prasugrel EP Impurity E

CAS: 1056459-37-0

Formula: C₂₀H₂₁ClFNO₃S

Molecular weight: 409.90

Ref: 4Z-P-3995

Prasugrel chloride impurity

CAS: 1056459-37-0

Prasugrel chloride impurity is an orally active antagonist of P2Y12 receptor, and inhibits ADP-induced platelet aggregation.

Formula: C₂₀H₂₁ClFNO₃S

Purity: 98%

Color and Shape: Solid

Molecular weight: 409.9

Ref: TM-T12534

Prasugrel chloride impurity

CAS: 1056459-37-0

Prasugrel chloride impurity is a research tool that is used in the study of cell biology and pharmacology. It is an activator, ligand, or receptor for ion channels and has been shown to inhibit the activity of L-type calcium channels. Prasugrel chloride impurity binds to two different epitopes on the alpha subunit of the human angiotensin II type 1 receptor (AT1R), thereby inhibiting its function. This drug has been shown to reduce platelet aggregation in vitro by preventing the binding of fibrinogen to glycoprotein IIb/IIIa receptors on platelets. It also inhibits thrombin-induced activation of protein C, which leads to decreased blood coagulation and increased blood clot stability.

Formula: C₂₀H₂₁ClFNO₃S

Purity: Min. 95%

Molecular weight: 409.9 g/mol

Ref: 3D-GSB45937

Prasugrel Chlorobutyryl analog

CAS: 1056459-37-0

Formula: C₂₀H₂₁ClFNO₃S

Molecular weight: 409.90

Ref: ST-EA-CP-P27015