CAS 1056474-39-5

2,4-Dimethyl-1-[(1E)-2-nitroethenyl]benzene

Description:

2,4-Dimethyl-1-[(1E)-2-nitroethenyl]benzene, identified by its CAS number 1056474-39-5, is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with two methyl groups and a nitroethenyl group. The presence of the nitro group introduces significant polarity and reactivity, making it a potential candidate for various chemical reactions, including electrophilic substitution. The compound's molecular structure suggests it may exhibit properties typical of both aromatic compounds and nitro derivatives, such as stability under certain conditions and potential for undergoing reduction reactions. Its physical properties, such as melting point, boiling point, and solubility, would depend on the specific arrangement of its substituents and the overall molecular interactions. Additionally, due to the presence of the nitro group, it may exhibit some degree of toxicity and environmental persistence, warranting careful handling and consideration in applications. Overall, this compound could be of interest in fields such as organic synthesis, materials science, and potentially in the development of pharmaceuticals or agrochemicals.

Formula: C₁₀H₁₁NO₂

InChI: InChI=1S/C10H11NO2/c1-8-3-4-10(9(2)7-8)5-6-11(12)13/h3-7H,1-2H3/b6-5+

InChI key: InChIKey=XPEOGJKNVJGVCE-AATRIKPKSA-N

SMILES: C(=C/N(=O)=O)\C1=C(C)C=C(C)C=C1

Synonyms:

• Benzene, 2,4-dimethyl-1-[(1E)-2-nitroethenyl]-
• 2,4-Dimethyl-1-[(1E)-2-nitroethenyl]benzene