CAS 1056615-74-7

6-Bromo-2-quinolinemethanamine

Description:

6-Bromo-2-quinolinemethanamine is an organic compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom in the heterocyclic ring. The presence of a bromine atom at the 6-position of the quinoline ring and an amine group attached to a methylene bridge contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the amine functionality. It can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, making it of interest in medicinal chemistry and organic synthesis. The bromine substituent can also serve as a useful handle for further functionalization. Additionally, compounds of this type may exhibit biological activity, potentially serving as intermediates in the synthesis of pharmaceuticals or agrochemicals. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity or reactivity.

Formula: C₁₀H₉BrN₂

InChI: InChI=1S/C10H9BrN2/c11-8-2-4-10-7(5-8)1-3-9(6-12)13-10/h1-5H,6,12H2

InChI key: InChIKey=BKBFDKKIZGWBDE-UHFFFAOYSA-N

SMILES: C(N)C1=NC2=C(C=C(Br)C=C2)C=C1

Synonyms:

• (6-Bromoquinolin-2-yl)methanamine
• 2-Quinolinemethanamine, 6-bromo-
• 6-Bromo-2-quinolinemethanamine