
CAS 1056639-88-3
:(2E)-N,3-Bis(1,3-benzodioxol-5-yl)-2-propenamide
Description:
(2E)-N,3-Bis(1,3-benzodioxol-5-yl)-2-propenamide, identified by its CAS number 1056639-88-3, is a synthetic organic compound characterized by its unique structural features. It contains a propenamide backbone, which is a derivative of acrylic acid, and is substituted with two benzodioxole moieties. The presence of these benzodioxole groups contributes to its potential biological activity, as they are known for their antioxidant and anti-inflammatory properties. The compound exhibits geometric isomerism due to the presence of a double bond in the propenamide structure, specifically existing in the trans configuration (2E). Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. Additionally, the compound's solubility, stability, and reactivity can be influenced by the functional groups present, making it a subject of interest for further research in organic synthesis and drug development. Overall, (2E)-N,3-Bis(1,3-benzodioxol-5-yl)-2-propenamide represents a fascinating example of a complex organic molecule with potential therapeutic implications.
Formula:C17H13NO5
InChI:InChI=1S/C17H13NO5/c19-17(18-12-3-5-14-16(8-12)23-10-21-14)6-2-11-1-4-13-15(7-11)22-9-20-13/h1-8H,9-10H2,(H,18,19)/b6-2+
InChI key:InChIKey=ZQAHKDUZHISWBE-QHHAFSJGSA-N
SMILES:N(C(/C=C/C=1C=C2C(=CC1)OCO2)=O)C=3C=C4C(=CC3)OCO4
Synonyms:- 2-Propenamide, N,3-bis(1,3-benzodioxol-5-yl)-, (2E)-
- (2E)-N,3-Bis(1,3-benzodioxol-5-yl)-2-propenamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.