CymitQuimica logo

CAS 105669-53-2

:

N-(2-Dimethylaminoethyl)-N-methylformamide

Description:
N-(2-Dimethylaminoethyl)-N-methylformamide, with the CAS number 105669-53-2, is an organic compound characterized by its amide functional group. It features a dimethylaminoethyl side chain, which contributes to its basicity and potential for hydrogen bonding. This compound is typically a colorless to pale yellow liquid with a distinctive odor. It is soluble in polar solvents, such as water and alcohols, due to the presence of the amide group, which enhances its ability to interact with other polar molecules. The presence of the dimethylamino group suggests that it may exhibit moderate to strong basic properties, making it useful in various chemical reactions, particularly in organic synthesis and as a potential intermediate in the production of pharmaceuticals. Additionally, it may have applications in the development of agrochemicals or as a solvent in chemical processes. Safety data should be consulted for handling and storage, as it may pose health risks if inhaled or absorbed through the skin.
Formula:C6H14N2O
InChI:InChI=1/C6H14N2O/c1-7(2)4-5-8(3)6-9/h6H,4-5H2,1-3H3
InChI key:CSLBJRKWKVBRSQ-UHFFFAOYSA-N
SMILES:CN(C)CCN(C)C=O
Found 5 products.