CAS 10568-00-0
:2-Isopropylamino-1-Phenyl-Ethanol hydrochloride
Description:
2-Isopropylamino-1-phenyl-ethanol hydrochloride, with the CAS number 10568-00-0, is a chemical compound that belongs to the class of amino alcohols. It features an isopropylamino group attached to a phenyl-ethanol backbone, which contributes to its unique properties. This compound is typically encountered as a hydrochloride salt, enhancing its solubility in water and making it suitable for various applications in pharmaceuticals and biochemistry. The presence of both an amino group and a hydroxyl group in its structure allows for potential interactions with biological systems, which may influence its pharmacological activity. It is important to note that the compound may exhibit specific characteristics such as melting point, solubility, and stability, which can vary based on environmental conditions and formulation. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken. Overall, 2-Isopropylamino-1-phenyl-ethanol hydrochloride is of interest in medicinal chemistry and related fields.
Formula:C11H18ClNO
InChI:InChI=1/C11H17NO.ClH/c1-9(2)12-8-11(13)10-6-4-3-5-7-10;/h3-7,9,11-13H,8H2,1-2H3;1H
SMILES:CC(C)NCC(c1ccccc1)O.Cl
Synonyms:- Benzenemethanol, alpha-(((1-methylethyl)amino)methyl)-, hydrochloride
- alpha-(((1-Methylethyl)amino)methyl)benzenemethanol hydrochloride
- 1-Phenyl-2-(Propan-2-Ylamino)Ethanol Hydrochloride (1:1)
- 2-(isopropylamino)-1-phenylethanol HCl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.