
CAS 105685-07-2
:1-(3-Methyl-7-benzofuranyl)piperazine
Description:
1-(3-Methyl-7-benzofuranyl)piperazine, identified by its CAS number 105685-07-2, is a chemical compound that features a piperazine ring substituted with a benzofuran moiety. This compound exhibits a unique structure that combines the properties of both piperazine and benzofuran, which can influence its biological activity and potential applications. Typically, compounds of this nature may demonstrate psychoactive properties, making them of interest in pharmacological research. The presence of the methyl group on the benzofuran enhances its lipophilicity, potentially affecting its interaction with biological membranes and receptors. Additionally, the piperazine ring is known for its versatility in medicinal chemistry, often serving as a scaffold for various therapeutic agents. The compound's solubility, stability, and reactivity can vary based on environmental conditions and the presence of functional groups. Overall, 1-(3-Methyl-7-benzofuranyl)piperazine represents a class of compounds that may have significant implications in drug development and therapeutic applications.
Formula:C13H16N2O
InChI:InChI=1S/C13H16N2O/c1-10-9-16-13-11(10)3-2-4-12(13)15-7-5-14-6-8-15/h2-4,9,14H,5-8H2,1H3
InChI key:InChIKey=AOXVGMLNSHXMQL-UHFFFAOYSA-N
SMILES:CC=1C=2C(=C(C=CC2)N3CCNCC3)OC1
Synonyms:- 1-(3-Methyl-1-benzofuran-7-yl)piperazine
- Piperazine, 1-(3-methyl-7-benzofuranyl)-
- 1-(3-Methyl-7-benzofuranyl)piperazine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.