CymitQuimica logo

CAS 105685-27-6

:

8-(1-Piperazinyl)isoquinoline

Description:
8-(1-Piperazinyl)isoquinoline is a chemical compound characterized by its isoquinoline core structure, which is a bicyclic aromatic compound. The presence of a piperazine moiety at the 8-position of the isoquinoline ring system contributes to its unique properties, including potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the piperazine nitrogen atoms, which can engage in hydrogen bonding. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. The piperazine group is known for its role in enhancing the pharmacokinetic properties of drug candidates, such as improving solubility and bioavailability. Additionally, compounds like 8-(1-Piperazinyl)isoquinoline may exhibit interactions with neurotransmitter receptors, making them of interest in neuropharmacology. Safety and handling precautions should be observed, as with any chemical substance, and further studies would be necessary to fully elucidate its properties and potential applications.
Formula:C13H15N3
InChI:InChI=1S/C13H15N3/c1-2-11-4-5-15-10-12(11)13(3-1)16-8-6-14-7-9-16/h1-5,10,14H,6-9H2
InChI key:InChIKey=SLTPPQIDSQSJIC-UHFFFAOYSA-N
SMILES:C=1(C2=C(C=CC1)C=CN=C2)N3CCNCC3
Synonyms:
  • 8-(1-Piperazinyl)isoquinoline
  • Isoquinoline, 8-(1-piperazinyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.