CymitQuimica logo

CAS 105686-08-6

:

1-[(2-Methoxyphenyl)methyl]-2,4,5-imidazolidinetrione

Description:
1-[(2-Methoxyphenyl)methyl]-2,4,5-imidazolidinetrione, with the CAS number 105686-08-6, is a chemical compound characterized by its imidazolidinetrione core structure, which features a five-membered ring containing nitrogen and carbon atoms. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds due to the presence of the methoxyphenyl group. The methoxy group contributes to its solubility in organic solvents and may influence its reactivity and biological activity. The imidazolidinetrione moiety suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as it may exhibit biological activity related to its structural features. Additionally, the presence of multiple functional groups can lead to diverse chemical reactivity, making it a candidate for further research in synthetic organic chemistry. Overall, this compound's unique structure and functional characteristics make it of interest in various fields, including drug development and materials science.
Formula:C11H10N2O4
InChI:InChI=1S/C11H10N2O4/c1-17-8-5-3-2-4-7(8)6-13-10(15)9(14)12-11(13)16/h2-5H,6H2,1H3,(H,12,14,16)
InChI key:InChIKey=HWVKAVORLIHKME-UHFFFAOYSA-N
SMILES:C(N1C(=O)NC(=O)C1=O)C2=C(OC)C=CC=C2
Synonyms:
  • 1-[(2-Methoxyphenyl)methyl]-2,4,5-imidazolidinetrione
  • Imidazolidinetrione, [(2-methoxyphenyl)methyl]-
  • 1-(2-Methoxybenzyl)imidazolidinetrione
  • 2,4,5-Imidazolidinetrione, 1-[(2-methoxyphenyl)methyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.