CymitQuimica logo

CAS 105687-87-4

:

1-chloro-3-(2-methyl-4,5-dinitro-1H-imidazol-1-yl)propan-2-ol

Description:
1-Chloro-3-(2-methyl-4,5-dinitro-1H-imidazol-1-yl)propan-2-ol is a chemical compound characterized by its complex structure, which includes a chloro group, a hydroxyl group, and a dinitro-substituted imidazole moiety. This compound is typically classified as a halogenated alcohol due to the presence of both chlorine and hydroxyl functional groups. The imidazole ring contributes to its potential biological activity, making it of interest in medicinal chemistry. The presence of nitro groups can enhance the compound's reactivity and influence its pharmacological properties. It is important to note that compounds with such structures may exhibit varying solubility in polar and non-polar solvents, and their stability can be affected by environmental conditions such as pH and temperature. Additionally, the compound may have specific applications in research or industry, particularly in the development of pharmaceuticals or agrochemicals. Safety data should be consulted for handling and potential hazards associated with this substance.
Formula:C7H9ClN4O5
InChI:InChI=1/C7H9ClN4O5/c1-4-9-6(11(14)15)7(12(16)17)10(4)3-5(13)2-8/h5,13H,2-3H2,1H3
SMILES:Cc1nc(c(n1CC(CCl)O)N(=O)=O)N(=O)=O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.