CAS 1056894-33-7
:3-Cinnolinemethanol
Description:
3-Cinnolinemethanol, identified by its CAS number 1056894-33-7, is a chemical compound characterized by the presence of a cinnoline ring structure, which is a bicyclic compound containing two nitrogen atoms in the ring. This compound features a hydroxymethyl group (-CH2OH) attached to the third position of the cinnoline ring, contributing to its unique chemical properties. 3-Cinnolinemethanol is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the hydroxymethyl group, which can engage in hydrogen bonding. The presence of the nitrogen atoms in the ring can also influence its reactivity and potential interactions with other chemical species. This compound may be of interest in various fields, including medicinal chemistry, due to its potential biological activities and applications in drug development. However, specific details regarding its toxicity, stability, and reactivity would require further investigation and analysis in a laboratory setting.
Formula:C9H8N2O
InChI:InChI=1S/C9H8N2O/c12-6-8-5-7-3-1-2-4-9(7)11-10-8/h1-5,12H,6H2
InChI key:InChIKey=VFVLNXYGKMNNEN-UHFFFAOYSA-N
SMILES:C(O)C1=CC2=C(N=N1)C=CC=C2
Synonyms:- 3-Cinnolinemethanol
- (Cinnolin-3-yl)methanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3-Cinnolinemethanol
CAS:Controlled ProductFormula:C9H8N2OColor and Shape:NeatMolecular weight:160.173
