CAS 10569-35-4
:2-PHENYL-3-(2-THIENYL)ACRYLIC ACID
Description:
2-Phenyl-3-(2-thienyl)acrylic acid is an organic compound characterized by its unique structure, which features both phenyl and thienyl groups attached to an acrylic acid backbone. This compound typically exhibits properties associated with unsaturated carboxylic acids, including the ability to participate in various chemical reactions such as polymerization and esterification. The presence of the thienyl group, a five-membered aromatic ring containing sulfur, contributes to its potential for interesting electronic and photophysical properties, making it of interest in materials science and organic synthesis. Additionally, the compound may display biological activity, which can be explored for pharmaceutical applications. Its solubility can vary depending on the solvent, and it may exhibit moderate stability under standard conditions. Overall, 2-phenyl-3-(2-thienyl)acrylic acid is a versatile compound with potential applications in various fields, including organic chemistry, materials science, and medicinal chemistry.
Formula:C13H9O2S
InChI:InChI=1/C13H10O2S/c14-13(15)12(9-11-7-4-8-16-11)10-5-2-1-3-6-10/h1-9H,(H,14,15)/p-1
SMILES:c1ccc(cc1)C(=Cc1cccs1)C(=O)[O-]
Synonyms:- (E)-2-Phenyl-3-(2-Thienyl)-2-Propenoic Acid
- 2-Phenyl-3-Thiophen-2-Yl-Acrylic Acid
- Akos Bc-0222
- (2E)-2-phenyl-3-thiophen-2-ylprop-2-enoic acid
- 2-Phenyl-3-Thiophen-2-Ylprop-2-Enoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.