CymitQuimica logo

CAS 105706-77-2

:

Phenylmethyl 2-ethenyl-1-pyrrolidinecarboxylate

Description:
Phenylmethyl 2-ethenyl-1-pyrrolidinecarboxylate, also known by its CAS number 105706-77-2, is an organic compound characterized by its complex structure, which includes a pyrrolidine ring, an ethylene group, and an ester functional group. This compound typically exhibits properties associated with esters, such as being relatively non-polar and having moderate solubility in organic solvents. Its molecular structure suggests potential applications in organic synthesis and medicinal chemistry, particularly due to the presence of the pyrrolidine moiety, which is often found in various bioactive compounds. The compound may also display interesting reactivity patterns, making it a candidate for further study in chemical reactions or as a building block in the synthesis of more complex molecules. Additionally, its unique combination of functional groups may impart specific biological activities, warranting investigation in pharmacological contexts. As with many organic compounds, safety data and handling precautions should be observed, as the compound may pose health risks if not managed properly.
Formula:C14H17NO2
InChI:InChI=1S/C14H17NO2/c1-2-13-9-6-10-15(13)14(16)17-11-12-7-4-3-5-8-12/h2-5,7-8,13H,1,6,9-11H2
InChI key:InChIKey=REODUIIKJBAGJE-UHFFFAOYSA-N
SMILES:C(OCC1=CC=CC=C1)(=O)N2C(C=C)CCC2
Synonyms:
  • 1-Pyrrolidinecarboxylic acid, 2-ethenyl-, phenylmethyl ester
  • Benzyl 2-vinylpyrrolidine-1-carboxylate
  • Phenylmethyl 2-ethenyl-1-pyrrolidinecarboxylate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.