CymitQuimica logo

CAS 1057076-52-4

:

Ethyl 6-chloro-1H-indole-5-carboxylate

Description:
Ethyl 6-chloro-1H-indole-5-carboxylate is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of a chloro substituent at the 6-position and an ethyl ester group at the 5-position contributes to its unique reactivity and properties. This compound typically appears as a solid or liquid, depending on the specific conditions, and is often used in organic synthesis and medicinal chemistry due to its potential biological activity. The ethyl ester functional group can undergo hydrolysis to yield the corresponding carboxylic acid, making it versatile in various chemical reactions. Additionally, the indole moiety is known for its presence in many natural products and pharmaceuticals, suggesting that derivatives like ethyl 6-chloro-1H-indole-5-carboxylate may exhibit interesting pharmacological properties. Safety data should be consulted for handling and storage, as halogenated compounds can pose specific health and environmental risks.
Formula:C11H10ClNO2
InChI:InChI=1S/C11H10ClNO2/c1-2-15-11(14)8-5-7-3-4-13-10(7)6-9(8)12/h3-6,13H,2H2,1H3
InChI key:InChIKey=LUIRXXMJEVXTCR-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C=1C=C2C(=CC1Cl)NC=C2
Synonyms:
  • Ethyl 6-chloro-1H-indole-5-carboxylate
  • 1H-Indole-5-carboxylic acid, 6-chloro-, ethyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.