CAS 10572-16-4
:3-(p-Nitrophenoxy)propionic Acid
Description:
3-(p-Nitrophenoxy)propionic acid is an organic compound characterized by its propionic acid backbone substituted with a p-nitrophenoxy group. This compound typically appears as a solid at room temperature and is soluble in polar solvents due to the presence of the carboxylic acid functional group. The p-nitrophenoxy moiety contributes to its chemical reactivity, particularly in electrophilic aromatic substitution reactions. The nitro group is a strong electron-withdrawing group, which can influence the acidity of the carboxylic acid, making it a stronger acid compared to unsubstituted propionic acid. This compound may exhibit biological activity, making it of interest in pharmaceutical and agrochemical research. Its synthesis often involves the reaction of p-nitrophenol with a suitable propionic acid derivative, followed by purification processes such as recrystallization. Safety data should be consulted, as nitro compounds can be hazardous, and appropriate handling and disposal procedures should be followed.
Formula:C9H8NO5
InChI:InChI=1/C9H9NO5/c11-9(12)5-6-15-8-3-1-7(2-4-8)10(13)14/h1-4H,5-6H2,(H,11,12)/p-1
SMILES:c1cc(ccc1N(=O)=O)OCCC(=O)[O-]
Synonyms:- 3-(4-Nitrophenoxy)propionic acid
- 3-(4-Nitrophenyl)Propionic Acid
- 3-(4-Nitrophenoxy)Propanoic Acid
- 3-(4-Nitrophenoxy)Propanoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-(4-Nitrophenoxy)propionic acid
CAS:Formula:C9H9NO5Purity:97%Color and Shape:SolidMolecular weight:211.17153-(4-Nitrophenoxy)propionic acid
CAS:3-(4-Nitrophenoxy)propionic acidPurity:97%Molecular weight:211.17g/mol3-(4-nitrophenoxy)propionic acid
CAS:Formula:C9H9NO5Purity:97%Color and Shape:SolidMolecular weight:211.1733-(4-Nitrophenoxy)propionic acid
CAS:3-(4-Nitrophenoxy)propionic acid is a promiscuous compound that can be used to synthesize other compounds. It reacts with hydrochloric acid, nitro groups, and phosphorus pentoxide to produce nitro compounds. 3-(4-Nitrophenoxy)propionic acid reacts with benzoylamine in the presence of a cocatalyst to form alkoxycarbonyl products. The cocatalyst is typically a metal such as zinc or magnesium. 3-(4-Nitrophenoxy)propionic acid is also used as an agrochemical for controlling influenza virus and Influenzae bacteria.
!--Formula:C9H9NO5Purity:Min. 95%Molecular weight:211.17 g/mol



