CAS 1057269-81-4
:1-[(3,5-Dichlorophenyl)methyl]-4-piperidinol
Description:
1-[(3,5-Dichlorophenyl)methyl]-4-piperidinol, identified by its CAS number 1057269-81-4, is a chemical compound characterized by its piperidine structure, which includes a piperidinol moiety. This compound features a dichlorophenyl group, specifically a 3,5-dichlorophenyl substituent, attached to the piperidine ring. The presence of chlorine atoms contributes to its lipophilicity and potential biological activity. Typically, compounds of this nature may exhibit properties such as moderate to high solubility in organic solvents and varying degrees of stability under different environmental conditions. The piperidinol structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as piperidine derivatives are often associated with various therapeutic effects. Additionally, the compound may possess specific pharmacological properties, which could be explored in the context of drug design and development. However, detailed studies would be necessary to fully elucidate its biological activity and potential applications.
Formula:C12H15Cl2NO
InChI:InChI=1S/C12H15Cl2NO/c13-10-5-9(6-11(14)7-10)8-15-3-1-12(16)2-4-15/h5-7,12,16H,1-4,8H2
InChI key:InChIKey=DZBSBAIYMVISFH-UHFFFAOYSA-N
SMILES:C(C1=CC(Cl)=CC(Cl)=C1)N2CCC(O)CC2
Synonyms:- 1-[(3,5-Dichlorophenyl)methyl]-4-piperidinol
- 4-Piperidinol, 1-[(3,5-dichlorophenyl)methyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.