
CAS 105729-09-7
:2-Methoxy-1-(2-thienyl)ethanone
Description:
2-Methoxy-1-(2-thienyl)ethanone, with the CAS number 105729-09-7, is an organic compound characterized by its unique structure, which includes a methoxy group and a thienyl moiety. This compound typically appears as a colorless to pale yellow liquid and is known for its aromatic properties due to the presence of the thienyl ring, which contributes to its potential applications in organic synthesis and as a building block in pharmaceuticals. The methoxy group enhances its solubility in organic solvents, making it useful in various chemical reactions. Additionally, 2-Methoxy-1-(2-thienyl)ethanone may exhibit interesting biological activities, although specific studies on its pharmacological effects may be limited. Its reactivity can be attributed to the carbonyl group, which can participate in nucleophilic addition reactions. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken during use. Overall, this compound represents a valuable entity in the field of organic chemistry and materials science.
Formula:C7H8O2S
InChI:InChI=1S/C7H8O2S/c1-9-5-6(8)7-3-2-4-10-7/h2-4H,5H2,1H3
InChI key:InChIKey=GNPJSVWAZAWZPR-UHFFFAOYSA-N
SMILES:C(COC)(=O)C1=CC=CS1
Synonyms:- 2-[(Methoxymethyl)carbonyl]thiophene
- 2-Methoxy-1-(2-thienyl)ethanone
- 2-Methoxy-1-(thiophen-2-yl)ethan-1-one
- Ethanone, 2-methoxy-1-(2-thienyl)-
- 2-(Methoxyacetyl)thiophene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.