CAS 105734-78-9
:5-methyl-1,2-benzothiazol-3-amine
Description:
5-Methyl-1,2-benzothiazol-3-amine is an organic compound characterized by its benzothiazole structure, which consists of a fused benzene and thiazole ring. This compound features a methyl group at the 5-position and an amino group at the 3-position of the benzothiazole ring. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amino group, which can engage in hydrogen bonding. The compound is of interest in various fields, including pharmaceuticals and materials science, due to its potential biological activity and utility as a building block in organic synthesis. Its reactivity is influenced by the electron-donating methyl group and the electron-withdrawing thiazole moiety, which can affect its interaction with other chemical species. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance. Overall, 5-methyl-1,2-benzothiazol-3-amine represents a versatile compound with significant implications in chemical research and application.
Formula:C8H8N2S
InChI:InChI=1/C8H8N2S/c1-5-2-3-7-6(4-5)8(9)10-11-7/h2-4H,1H3,(H2,9,10)
SMILES:Cc1ccc2c(c1)c(=N)[nH]s2
Synonyms:- 5-Methylbenzo[D]Isothiazol-3-Amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
