CymitQuimica logo

CAS 1057393-52-8

:

3-(2-Chlorophenyl)-7-iodo-1,2,4-triazolo[4,3-a]pyridine

Description:
3-(2-Chlorophenyl)-7-iodo-1,2,4-triazolo[4,3-a]pyridine is a heterocyclic compound characterized by its complex structure, which includes a triazole ring fused to a pyridine moiety. The presence of a 2-chlorophenyl group and an iodine atom at specific positions contributes to its unique chemical properties. This compound is typically studied for its potential biological activities, including antimicrobial and anticancer properties, due to the presence of halogen substituents that can enhance reactivity and interaction with biological targets. The triazole ring is known for its ability to form hydrogen bonds, which can influence the compound's solubility and stability. Additionally, the iodine atom may impart specific electronic characteristics, affecting the compound's reactivity and interaction with other molecules. Overall, this substance is of interest in medicinal chemistry and drug development, where modifications to its structure can lead to the discovery of new therapeutic agents.
Formula:C12H7ClIN3
InChI:InChI=1S/C12H7ClIN3/c13-10-4-2-1-3-9(10)12-16-15-11-7-8(14)5-6-17(11)12/h1-7H
InChI key:InChIKey=LSTUEASFRFLQIA-UHFFFAOYSA-N
SMILES:ClC1=C(C=2N3C(=NN2)C=C(I)C=C3)C=CC=C1
Synonyms:
  • 3-(2-Chlorophenyl)-7-iodo-1,2,4-triazolo[4,3-a]pyridine
  • 3-(2-Chlorophenyl)-7-iodo-[1,2,4]triazolo[4,3-a]pyridine
  • 1,2,4-Triazolo[4,3-a]pyridine, 3-(2-chlorophenyl)-7-iodo-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.