
CAS 1057393-55-1
:4-Chloro-N-cyclopropyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide
Description:
4-Chloro-N-cyclopropyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide is a chemical compound characterized by its complex structure, which includes a chloro substituent, a cyclopropyl group, and a dioxaborolane moiety. The presence of the chloro group indicates potential reactivity, particularly in nucleophilic substitution reactions. The cyclopropyl group contributes to the compound's rigidity and may influence its biological activity. The dioxaborolane unit is notable for its ability to form stable complexes with various nucleophiles, making it useful in synthetic chemistry, particularly in the context of boron chemistry. This compound may exhibit specific pharmacological properties, potentially acting as a pharmaceutical intermediate or a lead compound in drug development. Its solubility, stability, and reactivity can be influenced by the functional groups present, and it may undergo various chemical transformations under different conditions. Overall, this compound represents a unique combination of structural features that may lend itself to diverse applications in organic synthesis and medicinal chemistry.
Formula:C16H21BClNO3
InChI:InChI=1S/C16H21BClNO3/c1-15(2)16(3,4)22-17(21-15)12-9-10(5-8-13(12)18)14(20)19-11-6-7-11/h5,8-9,11H,6-7H2,1-4H3,(H,19,20)
InChI key:InChIKey=MWVKDUXHCDGVAM-UHFFFAOYSA-N
SMILES:ClC=1C(B2OC(C)(C)C(C)(C)O2)=CC(C(NC3CC3)=O)=CC1
Synonyms:- 4-Chloro-N-cyclopropyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide
- Benzamide, 4-chloro-N-cyclopropyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.