
CAS 10574-66-0
:3-Ethyl-2-thioxo-4-oxazolidinone
Description:
3-Ethyl-2-thioxo-4-oxazolidinone, with the CAS number 10574-66-0, is a heterocyclic compound characterized by its oxazolidinone ring structure, which incorporates both sulfur and oxygen atoms. This compound features a thioxo group, indicating the presence of a sulfur atom double-bonded to a carbon atom within the ring, contributing to its unique reactivity and properties. The ethyl substituent at the 3-position enhances its lipophilicity, potentially influencing its solubility and interaction with biological systems. 3-Ethyl-2-thioxo-4-oxazolidinone may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its structural features suggest potential applications in the synthesis of various derivatives, which could be explored for their biological activities. Additionally, the presence of the oxazolidinone framework is significant in the development of antimicrobial agents, as similar compounds have been utilized in antibiotic formulations. Overall, this compound represents a valuable entity in the field of organic chemistry and drug development.
Formula:C5H7NO2S
InChI:InChI=1S/C5H7NO2S/c1-2-6-4(7)3-8-5(6)9/h2-3H2,1H3
InChI key:InChIKey=ZILKBTSQUZJHOI-UHFFFAOYSA-N
SMILES:C(C)N1C(=O)COC1=S
Synonyms:- 2,4-Oxazolidinedione, 3-ethyl-2-thio-
- 4-Oxazolidinone, 3-ethyl-2-thioxo-
- 3-Ethyl-2-thioxo-4-oxazolidinone
- 3-Ethyl-2-sulfanylidene-1,3-oxazolidin-4-one
- 3-Ethyl-2-thio-2,4-oxazolidinedione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.