
CAS 10574-70-6
:3-(4-Bromophenyl)-2-thioxo-4-thiazolidinone
Description:
3-(4-Bromophenyl)-2-thioxo-4-thiazolidinone, with the CAS number 10574-70-6, is a heterocyclic compound featuring a thiazolidinone core. This compound is characterized by the presence of a thiazolidine ring, which includes a sulfur atom and a carbonyl group, contributing to its thioxo functionality. The 4-bromophenyl substituent enhances its lipophilicity and may influence its biological activity. Typically, compounds of this class exhibit a range of pharmacological properties, including antimicrobial and anti-inflammatory activities, making them of interest in medicinal chemistry. The thiazolidinone structure allows for potential interactions with biological targets, and the bromine substituent can enhance reactivity or selectivity in chemical reactions. Additionally, the compound's solubility, stability, and reactivity can be influenced by the presence of the bromine atom and the thiazolidine framework. Overall, 3-(4-Bromophenyl)-2-thioxo-4-thiazolidinone represents a significant structure in the study of bioactive compounds and their potential therapeutic applications.
Formula:C9H6BrNOS2
InChI:InChI=1S/C9H6BrNOS2/c10-6-1-3-7(4-2-6)11-8(12)5-14-9(11)13/h1-4H,5H2
InChI key:InChIKey=SQELHPVHPKNYGI-UHFFFAOYSA-N
SMILES:O=C1N(C(=S)SC1)C2=CC=C(Br)C=C2
Synonyms:- 3-(4-Bromophenyl)rhodanine
- 4-Thiazolidinone, 3-(4-bromophenyl)-2-thioxo-
- Rhodanine, 3-(p-bromophenyl)-
- 3-(p-Bromophenyl)rhodanine
- 3-(4-Bromophenyl)-2-thioxo-4-thiazolidinone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.