CAS 1057404-45-1
:5-Bromo-3-chloro-1-methyl-1H-indole-2-carboxylic acid
Description:
5-Bromo-3-chloro-1-methyl-1H-indole-2-carboxylic acid is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This particular compound features a bromine atom at the 5-position and a chlorine atom at the 3-position of the indole ring, along with a methyl group at the 1-position and a carboxylic acid functional group at the 2-position. The presence of these halogen substituents can influence the compound's reactivity, solubility, and biological activity. Typically, compounds like this may exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. The carboxylic acid group contributes to its acidity and potential for forming salts or esters. Additionally, the compound's molecular structure suggests it may participate in various chemical reactions, including electrophilic substitutions and coupling reactions, which are common in organic synthesis. Overall, 5-Bromo-3-chloro-1-methyl-1H-indole-2-carboxylic acid is a versatile compound with potential applications in research and development.
Formula:C10H7BrClNO2
InChI:InChI=1S/C10H7BrClNO2/c1-13-7-3-2-5(11)4-6(7)8(12)9(13)10(14)15/h2-4H,1H3,(H,14,15)
InChI key:InChIKey=GOEDPNDRUSDMEP-UHFFFAOYSA-N
SMILES:CN1C=2C(C(Cl)=C1C(O)=O)=CC(Br)=CC2
Synonyms:- 5-Bromo-3-chloro-1-methyl-1H-indole-2-carboxylic acid
- 1H-Indole-2-carboxylic acid, 5-bromo-3-chloro-1-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.