CAS 105746-46-1

D-Phenylalanine, N-[[4-(1,1-dimethylethyl)cyclohexyl]carbonyl]-, trans-

Description:

D-Phenylalanine, N-[[4-(1,1-dimethylethyl)cyclohexyl]carbonyl]-, trans- is a synthetic compound that belongs to the class of amino acids, specifically a derivative of phenylalanine. This compound features a phenylalanine backbone, which is an essential amino acid important for protein synthesis and neurotransmitter function. The presence of a bulky tert-butyl group attached to a cyclohexyl carbonyl moiety contributes to its unique steric and electronic properties, potentially influencing its biological activity and solubility. The trans configuration indicates the specific spatial arrangement of the substituents around the carbonyl group, which can affect the compound's interactions with biological targets. D-Phenylalanine derivatives are often studied for their potential therapeutic applications, including pain relief and mood enhancement, due to their influence on endorphin levels. As with many chemical substances, safety and handling precautions should be observed, as the compound may exhibit specific reactivity or toxicity profiles.

Formula: C₂₀H₂₉NO₃

InChI: InChI=1S/C20H29NO3/c1-20(2,3)16-11-9-15(10-12-16)18(22)21-17(19(23)24)13-14-7-5-4-6-8-14/h4-8,15-17H,9-13H2,1-3H3,(H,21,22)(H,23,24)

InChI key: InChIKey=SYWRPZFKQKXPIE-UHFFFAOYSA-N

SMILES: C(NC(CC1=CC=CC=C1)C(O)=O)(=O)C2CCC(C(C)(C)C)CC2

Synonyms:

• D-Phenylalanine, N-[[4-(1,1-dimethylethyl)cyclohexyl]carbonyl]-, trans-