
CAS 1057641-73-2
:[[(3-Methylenecyclobutyl)oxy]methyl]benzene
Description:
[[3-Methylenecyclobutyl)oxy]methyl]benzene, identified by its CAS number 1057641-73-2, is an organic compound characterized by its unique structure that combines a methylenecyclobutyl group with a benzene ring. This compound features a methylene bridge connecting the cyclobutyl moiety to a benzene, which can influence its reactivity and physical properties. Typically, compounds of this nature may exhibit moderate to high lipophilicity due to the presence of the aromatic benzene ring, potentially affecting their solubility in organic solvents. The cyclobutyl group can introduce strain into the molecular structure, which may lead to interesting chemical behavior, such as increased reactivity in certain reactions. Additionally, the presence of the ether-like linkage (the oxygen atom) can impart specific functional properties, such as the ability to participate in hydrogen bonding or act as a site for further chemical modifications. Overall, the characteristics of this compound suggest potential applications in organic synthesis, materials science, or as intermediates in the development of pharmaceuticals.
Formula:C12H14O
InChI:InChI=1S/C12H14O/c1-10-7-12(8-10)13-9-11-5-3-2-4-6-11/h2-6,12H,1,7-9H2
InChI key:InChIKey=UEGQHXFPWDNFGH-UHFFFAOYSA-N
SMILES:O(CC1=CC=CC=C1)C2CC(=C)C2
Synonyms:- ((3-Methylenecyclobutoxy)methyl)benzene
- [[(3-Methylenecyclobutyl)oxy]methyl]benzene
- Benzene, [[(3-methylenecyclobutyl)oxy]methyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.