CAS 1057663-22-5

2,4-Dimethoxy-1-(2-propyn-1-yl)benzene

Description:

2,4-Dimethoxy-1-(2-propyn-1-yl)benzene, identified by its CAS number 1057663-22-5, is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with two methoxy groups and a propynyl side chain. The presence of the methoxy groups at the 2 and 4 positions on the benzene ring enhances its electron-donating properties, potentially influencing its reactivity and solubility in various solvents. The propynyl group introduces a triple bond, which can participate in further chemical reactions, making the compound versatile in synthetic applications. This compound may exhibit interesting biological activities due to its structural features, and its derivatives are often explored in medicinal chemistry. Additionally, its physical properties, such as melting point, boiling point, and solubility, would depend on the specific molecular interactions and the environment in which it is studied. Overall, 2,4-Dimethoxy-1-(2-propyn-1-yl)benzene is a compound of interest in both organic synthesis and potential pharmacological applications.

Formula: C₁₁H₁₂O₂

InChI: InChI=1S/C11H12O2/c1-4-5-9-6-7-10(12-2)8-11(9)13-3/h1,6-8H,5H2,2-3H3

InChI key: InChIKey=WWBLEBBRIAFILE-UHFFFAOYSA-N

SMILES: C(C#C)C1=C(OC)C=C(OC)C=C1

Synonyms:

• Benzene, 2,4-dimethoxy-1-(2-propyn-1-yl)-
• 2,4-Dimethoxy-1-(2-propyn-1-yl)benzene