CAS 1057667-16-9
:N-(5-Methoxy-2-pyrimidinyl)hexanamide
Description:
N-(5-Methoxy-2-pyrimidinyl)hexanamide is a chemical compound characterized by its pyrimidine ring structure, which is substituted at the 5-position with a methoxy group and linked to a hexanamide chain. This compound features a pyrimidine moiety, which is a six-membered aromatic ring containing two nitrogen atoms at the 1 and 3 positions, contributing to its potential biological activity. The hexanamide portion indicates the presence of a six-carbon aliphatic chain terminating in an amide functional group, which can influence the compound's solubility and reactivity. The methoxy group enhances the lipophilicity of the molecule, potentially affecting its pharmacokinetic properties. Overall, this compound may exhibit interesting properties for medicinal chemistry, particularly in the development of pharmaceuticals, due to the combination of its aromatic and aliphatic characteristics. Its specific applications and biological activities would depend on further research and characterization.
Formula:C11H17N3O2
InChI:InChI=1S/C11H17N3O2/c1-3-4-5-6-10(15)14-11-12-7-9(16-2)8-13-11/h7-8H,3-6H2,1-2H3,(H,12,13,14,15)
InChI key:InChIKey=ZWBNJFBMNQGACS-UHFFFAOYSA-N
SMILES:N(C(CCCCC)=O)C=1N=CC(OC)=CN1
Synonyms:- N-(5-Methoxy-2-pyrimidinyl)hexanamide
- N-(5-Methoxypyrimidin-2-yl)hexanamide
- Hexanamide, N-(5-methoxy-2-pyrimidinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
