
CAS 1057669-95-0
:2-Ethynyl-5-methoxyphenol
Description:
2-Ethynyl-5-methoxyphenol, identified by its CAS number 1057669-95-0, is an organic compound characterized by its phenolic structure, which includes a methoxy group and an ethynyl substituent. This compound typically appears as a solid and is known for its potential applications in various fields, including pharmaceuticals and materials science. The presence of the ethynyl group contributes to its reactivity, making it a useful intermediate in organic synthesis. The methoxy group enhances its solubility in organic solvents and may influence its biological activity. Additionally, the compound may exhibit antioxidant properties due to the phenolic hydroxyl group, which can donate hydrogen atoms to free radicals. Its unique structure allows for potential modifications that can lead to derivatives with varied properties and applications. As with many organic compounds, safety data should be consulted to understand its handling, storage, and potential hazards. Overall, 2-Ethynyl-5-methoxyphenol is a compound of interest in both research and industrial contexts.
Formula:C9H8O2
InChI:InChI=1S/C9H8O2/c1-3-7-4-5-8(11-2)6-9(7)10/h1,4-6,10H,2H3
InChI key:InChIKey=OXOONUQMEBUCOZ-UHFFFAOYSA-N
SMILES:O(C)C1=CC(O)=C(C#C)C=C1
Synonyms:- 2-Ethynyl-5-methoxyphenol
- Phenol, 2-ethynyl-5-methoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.