CymitQuimica logo

CAS 1057670-84-4

:

2,3-Dichlorobenzenepropanal

Description:
2,3-Dichlorobenzenepropanal is an organic compound characterized by its structure, which includes a propanal group attached to a dichlorobenzene ring. The presence of two chlorine atoms on the benzene ring significantly influences its chemical properties, including increased reactivity and altered polarity compared to non-chlorinated analogs. This compound typically exhibits a colorless to pale yellow appearance and has a distinct aromatic odor. It is likely to be soluble in organic solvents but may have limited solubility in water due to its hydrophobic benzene ring. The dichlorinated structure can lead to various chemical behaviors, including potential electrophilic substitution reactions. Additionally, 2,3-Dichlorobenzenepropanal may be of interest in synthetic organic chemistry and could serve as an intermediate in the synthesis of more complex molecules. Safety data should be consulted, as halogenated compounds can pose health risks and environmental concerns. Proper handling and disposal methods are essential when working with this substance in a laboratory setting.
Formula:C9H8Cl2O
InChI:InChI=1S/C9H8Cl2O/c10-8-5-1-3-7(9(8)11)4-2-6-12/h1,3,5-6H,2,4H2
InChI key:InChIKey=FFXMFAOIAOPXMY-UHFFFAOYSA-N
SMILES:C(CC=O)C1=C(Cl)C(Cl)=CC=C1
Synonyms:
  • 2,3-Dichlorobenzenepropanal
  • Benzenepropanal, 2,3-dichloro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.