CAS 1057670-92-4

2,6-Difluorobenzenepropanal

Description:

2,6-Difluorobenzenepropanal is an organic compound characterized by its structure, which features a propanal group attached to a benzene ring that has two fluorine atoms substituted at the 2 and 6 positions. This compound belongs to the class of aromatic aldehydes, which are known for their distinctive odors and reactivity due to the presence of the aldehyde functional group. The fluorine substituents can significantly influence the compound's chemical properties, including its reactivity, polarity, and boiling point, due to the electronegative nature of fluorine. As a result, 2,6-difluorobenzenepropanal may exhibit unique behavior in chemical reactions, particularly in electrophilic aromatic substitution and nucleophilic addition reactions. Additionally, the presence of fluorine can enhance the compound's stability and alter its solubility in various solvents. While specific applications may vary, compounds of this nature are often explored in fields such as pharmaceuticals, agrochemicals, and materials science for their potential utility in synthesis and as intermediates in chemical reactions.

Formula: C₉H₈F₂O

InChI: InChI=1S/C9H8F2O/c10-8-4-1-5-9(11)7(8)3-2-6-12/h1,4-6H,2-3H2

InChI key: InChIKey=XEHBLZJNYMOGGJ-UHFFFAOYSA-N

SMILES: C(CC=O)C1=C(F)C=CC=C1F

Synonyms:

• 2,6-Difluorobenzenepropanal
• Benzenepropanal, 2,6-difluoro-